C24H20FN3O3S2 — CID 175246075
N-fluoro-N-[[3-[[5-(2-methylbenzoyl)-1,3-thiazol-2-yl]amino]phenyl]methyl]benzenesulfonamide (PubChem CID 175246075) has the molecular formula C24H20FN3O3S2 and a molecular weight of 481.57 g/mol. Its IUPAC name is N-fluoro-N-[[3-[[5-(2-methylbenzoyl)-1,3-thiazol-2-yl]amino]phenyl]methyl]benzenesulfonamide.
| Compound Name | N-fluoro-N-[[3-[[5-(2-methylbenzoyl)-1,3-thiazol-2-yl]amino]phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 175246075 |
| Molecular Formula | C24H20FN3O3S2 |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | N-fluoro-N-[[3-[[5-(2-methylbenzoyl)-1,3-thiazol-2-yl]amino]phenyl]methyl]benzenesulfonamide |
| SMILES | Cc1ccccc1C(=O)c1cnc(Nc2cccc(CN(F)S(=O)(=O)c3ccccc3)c2)s1 |
| InChI | InChI=1S/C24H20FN3O3S2/c1-17-8-5-6-13-21(17)23(29)22-15-26-24(32-22)27-19-10-7-9-18(14-19)16-28(25)33(30,31)20-11-3-2-4-12-20/h2-15H,16H2,1H3,(H,26,27) |
| InChIKey | HXLXTICIOJWWSF-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|