C10H17Cl2Zr- — CID 174501530
2-pentan-2-ylcyclopenta-1,3-diene;zirconium;dihydrochloride (PubChem CID 174501530) has the molecular formula C10H17Cl2Zr- and a molecular weight of 299.38 g/mol. Its IUPAC name is 2-pentan-2-ylcyclopenta-1,3-diene;zirconium;dihydrochloride.
| Compound Name | 2-pentan-2-ylcyclopenta-1,3-diene;zirconium;dihydrochloride |
|---|---|
| PubChem CID | 174501530 |
| Molecular Formula | C10H17Cl2Zr- |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 296.98 |
| IUPAC Name | 2-pentan-2-ylcyclopenta-1,3-diene;zirconium;dihydrochloride |
| SMILES | CCCC(C)C1=CC[C-]=C1.Cl.Cl.[Zr] |
| InChI | InChI=1S/C10H15.2ClH.Zr/c1-3-6-9(2)10-7-4-5-8-10;;;/h7-9H,3-4,6H2,1-2H3;2*1H;/q-1;;; |
| InChIKey | UYENGQRXPCRTFT-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|