C16H26N2O3 — CID 174503434
tert-butyl 2-amino-2-[6-(1-hydroxy-3-methylbutyl)-3-pyridinyl]acetate (PubChem CID 174503434) has the molecular formula C16H26N2O3 and a molecular weight of 294.40 g/mol. Its IUPAC name is tert-butyl 2-amino-2-[6-(1-hydroxy-3-methylbutyl)-3-pyridinyl]acetate.
| Compound Name | tert-butyl 2-amino-2-[6-(1-hydroxy-3-methylbutyl)-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 174503434 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | tert-butyl 2-amino-2-[6-(1-hydroxy-3-methylbutyl)-3-pyridinyl]acetate |
| SMILES | CC(C)CC(O)c1ccc(C(N)C(=O)OC(C)(C)C)cn1 |
| InChI | InChI=1S/C16H26N2O3/c1-10(2)8-13(19)12-7-6-11(9-18-12)14(17)15(20)21-16(3,4)5/h6-7,9-10,13-14,19H,8,17H2,1-5H3 |
| InChIKey | VRMXFGWRARGCCA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |