C23H28N4O3 — CID 174505120
2-[[3-(2-iminobutyl)phenyl]methyl-methylamino]-6,7-dimethoxy-5-methyl-3H-quinazolin-4-one (PubChem CID 174505120) has the molecular formula C23H28N4O3 and a molecular weight of 408.50 g/mol. Its IUPAC name is 2-[[3-(2-iminobutyl)phenyl]methyl-methylamino]-6,7-dimethoxy-5-methyl-3H-quinazolin-4-one.
| Compound Name | 2-[[3-(2-iminobutyl)phenyl]methyl-methylamino]-6,7-dimethoxy-5-methyl-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 174505120 |
| Molecular Formula | C23H28N4O3 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 2-[[3-(2-iminobutyl)phenyl]methyl-methylamino]-6,7-dimethoxy-5-methyl-3H-quinazolin-4-one |
| SMILES | [H]/N=C(\CC)Cc1cccc(CN(C)c2nc3cc(OC)c(OC)c(C)c3c(=O)[nH]2)c1 |
| InChI | InChI=1S/C23H28N4O3/c1-6-17(24)11-15-8-7-9-16(10-15)13-27(3)23-25-18-12-19(29-4)21(30-5)14(2)20(18)22(28)26-23/h7-10,12,24H,6,11,13H2,1-5H3,(H,25,26,28)/b24-17+ |
| InChIKey | YJMXJIQPLFJVRG-JJIBRWJFSA-N |
| XLogP | 3.86 |
| TPSA | 91.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|