C13H22N2O4 — CID 174506032
tert-butyl formate;5-piperidin-4-yl-1,2-oxazol-3-one (PubChem CID 174506032) has the molecular formula C13H22N2O4 and a molecular weight of 270.33 g/mol. Its IUPAC name is tert-butyl formate;5-piperidin-4-yl-1,2-oxazol-3-one.
| Compound Name | tert-butyl formate;5-piperidin-4-yl-1,2-oxazol-3-one |
|---|---|
| PubChem CID | 174506032 |
| Molecular Formula | C13H22N2O4 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | tert-butyl formate;5-piperidin-4-yl-1,2-oxazol-3-one |
| SMILES | CC(C)(C)OC=O.O=c1cc(C2CCNCC2)o[nH]1 |
| InChI | InChI=1S/C8H12N2O2.C5H10O2/c11-8-5-7(12-10-8)6-1-3-9-4-2-6;1-5(2,3)7-4-6/h5-6,9H,1-4H2,(H,10,11);4H,1-3H3 |
| InChIKey | HQGWECWFCXVFKX-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|