C15H26N2O3S — CID 174750957
tert-butyl formate;1-(2-piperidin-4-yl-1,3-thiazol-4-yl)ethanol (PubChem CID 174750957) has the molecular formula C15H26N2O3S and a molecular weight of 314.45 g/mol. Its IUPAC name is tert-butyl formate;1-(2-piperidin-4-yl-1,3-thiazol-4-yl)ethanol.
| Compound Name | tert-butyl formate;1-(2-piperidin-4-yl-1,3-thiazol-4-yl)ethanol |
|---|---|
| PubChem CID | 174750957 |
| Molecular Formula | C15H26N2O3S |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | tert-butyl formate;1-(2-piperidin-4-yl-1,3-thiazol-4-yl)ethanol |
| SMILES | CC(C)(C)OC=O.CC(O)c1csc(C2CCNCC2)n1 |
| InChI | InChI=1S/C10H16N2OS.C5H10O2/c1-7(13)9-6-14-10(12-9)8-2-4-11-5-3-8;1-5(2,3)7-4-6/h6-8,11,13H,2-5H2,1H3;4H,1-3H3 |
| InChIKey | VVWFSMIFMCUBHC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|