About tert-butyl formate;1-(2-piperidin-4-yl-1,3-thiazol-4-yl)ethanol
tert-butyl formate;1-(2-piperidin-4-yl-1,3-thiazol-4-yl)ethanol (PubChem CID 174750957) has the molecular formula C15H26N2O3S
and a molecular weight of 314.45 g/mol. Its IUPAC name is tert-butyl formate;1-(2-piperidin-4-yl-1,3-thiazol-4-yl)ethanol.
Molecular Properties
| Compound Name | tert-butyl formate;1-(2-piperidin-4-yl-1,3-thiazol-4-yl)ethanol |
| PubChem CID | 174750957 |
| Molecular Formula | C15H26N2O3S |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | tert-butyl formate;1-(2-piperidin-4-yl-1,3-thiazol-4-yl)ethanol |
| SMILES | CC(C)(C)OC=O.CC(O)c1csc(C2CCNCC2)n1 |
| InChI | InChI=1S/C10H16N2OS.C5H10O2/c1-7(13)9-6-14-10(12-9)8-2-4-11-5-3-8;1-5(2,3)7-4-6/h6-8,11,13H,2-5H2,1H3;4H,1-3H3 |
| InChIKey | VVWFSMIFMCUBHC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl formate;1-(2-piperidin-4-yl-1,3-thiazol-4-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl formate;1-(2-piperidin-4-yl-1,3-thiazol-4-yl)ethanol?
The IUPAC name of tert-butyl formate;1-(2-piperidin-4-yl-1,3-thiazol-4-yl)ethanol (CID 174750957) is tert-butyl formate;1-(2-piperidin-4-yl-1,3-thiazol-4-yl)ethanol.
What is the SMILES notation for tert-butyl formate;1-(2-piperidin-4-yl-1,3-thiazol-4-yl)ethanol?
The canonical SMILES for tert-butyl formate;1-(2-piperidin-4-yl-1,3-thiazol-4-yl)ethanol is CC(C)(C)OC=O.CC(O)c1csc(C2CCNCC2)n1.
What is the InChIKey of tert-butyl formate;1-(2-piperidin-4-yl-1,3-thiazol-4-yl)ethanol?
The InChIKey is VVWFSMIFMCUBHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2OS.C5H10O2/c1-7(13)9-6-14-10(12-9)8-2-4-11-5-3-8;1-5(2,3)7-4-6/h6-8,11,13H,2-5H2,1H3;4H,1-3H3.
What are the key properties of tert-butyl formate;1-(2-piperidin-4-yl-1,3-thiazol-4-yl)ethanol?
tert-butyl formate;1-(2-piperidin-4-yl-1,3-thiazol-4-yl)ethanol has a molecular weight of 314.45 g/mol, XLogP of 2.62, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl formate;1-(2-piperidin-4-yl-1,3-thiazol-4-yl)ethanol is sourced from PubChem (CID 174750957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).