C23H37N3O3S — CID 174632478
3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-(2-piperidin-4-yl-1,3-thiazol-4-yl)methanone;tert-butyl formate (PubChem CID 174632478) has the molecular formula C23H37N3O3S and a molecular weight of 435.63 g/mol. Its IUPAC name is 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-(2-piperidin-4-yl-1,3-thiazol-4-yl)methanone;tert-butyl formate.
| Compound Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-(2-piperidin-4-yl-1,3-thiazol-4-yl)methanone;tert-butyl formate |
|---|---|
| PubChem CID | 174632478 |
| Molecular Formula | C23H37N3O3S |
| Molecular Weight | 435.63 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-(2-piperidin-4-yl-1,3-thiazol-4-yl)methanone;tert-butyl formate |
| SMILES | CC(C)(C)OC=O.O=C(c1csc(C2CCNCC2)n1)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C18H27N3OS.C5H10O2/c22-18(21-11-3-5-13-4-1-2-6-16(13)21)15-12-23-17(20-15)14-7-9-19-10-8-14;1-5(2,3)7-4-6/h12-14,16,19H,1-11H2;4H,1-3H3 |
| InChIKey | KWQURAUMQDVEHH-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.63 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|