C28H37N3O2S — CID 66886893
1-[4-[4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl)-1,3-thiazol-2-yl]piperidin-1-yl]-2-phenylbutan-1-one (PubChem CID 66886893) has the molecular formula C28H37N3O2S and a molecular weight of 479.69 g/mol. Its IUPAC name is 1-[4-[4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl)-1,3-thiazol-2-yl]piperidin-1-yl]-2-phenylbutan-1-one.
| Compound Name | 1-[4-[4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl)-1,3-thiazol-2-yl]piperidin-1-yl]-2-phenylbutan-1-one |
|---|---|
| PubChem CID | 66886893 |
| Molecular Formula | C28H37N3O2S |
| Molecular Weight | 479.69 g/mol |
| Exact Mass | 479.26 |
| IUPAC Name | 1-[4-[4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carbonyl)-1,3-thiazol-2-yl]piperidin-1-yl]-2-phenylbutan-1-one |
| SMILES | CCC(C(=O)N1CCC(c2nc(C(=O)N3CCCC4CCCCC43)cs2)CC1)c1ccccc1 |
| InChI | InChI=1S/C28H37N3O2S/c1-2-23(20-9-4-3-5-10-20)27(32)30-17-14-22(15-18-30)26-29-24(19-34-26)28(33)31-16-8-12-21-11-6-7-13-25(21)31/h3-5,9-10,19,21-23,25H,2,6-8,11-18H2,1H3 |
| InChIKey | QKXKDIAWHUYNER-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.69 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |