C17H26ClNO3 — CID 174928815
tert-butyl formate;(3-chloro-4-piperidin-4-ylphenyl)methanol (PubChem CID 174928815) has the molecular formula C17H26ClNO3 and a molecular weight of 327.85 g/mol. Its IUPAC name is tert-butyl formate;(3-chloro-4-piperidin-4-ylphenyl)methanol.
| Compound Name | tert-butyl formate;(3-chloro-4-piperidin-4-ylphenyl)methanol |
|---|---|
| PubChem CID | 174928815 |
| Molecular Formula | C17H26ClNO3 |
| Molecular Weight | 327.85 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | tert-butyl formate;(3-chloro-4-piperidin-4-ylphenyl)methanol |
| SMILES | CC(C)(C)OC=O.OCc1ccc(C2CCNCC2)c(Cl)c1 |
| InChI | InChI=1S/C12H16ClNO.C5H10O2/c13-12-7-9(8-15)1-2-11(12)10-3-5-14-6-4-10;1-5(2,3)7-4-6/h1-2,7,10,14-15H,3-6,8H2;4H,1-3H3 |
| InChIKey | CQWVSDXVCWGAPD-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.85 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|