C14H14ClF3N2O4S2 — CID 174509444
[2-chloro-5-(trifluoromethyl)phenyl] 2-amino-5-(4-hydroxybutyl)-1,3-thiazole-4-sulfonate (PubChem CID 174509444) has the molecular formula C14H14ClF3N2O4S2 and a molecular weight of 430.86 g/mol. Its IUPAC name is [2-chloro-5-(trifluoromethyl)phenyl] 2-amino-5-(4-hydroxybutyl)-1,3-thiazole-4-sulfonate.
| Compound Name | [2-chloro-5-(trifluoromethyl)phenyl] 2-amino-5-(4-hydroxybutyl)-1,3-thiazole-4-sulfonate |
|---|---|
| PubChem CID | 174509444 |
| Molecular Formula | C14H14ClF3N2O4S2 |
| Molecular Weight | 430.86 g/mol |
| Exact Mass | 430.00 |
| IUPAC Name | [2-chloro-5-(trifluoromethyl)phenyl] 2-amino-5-(4-hydroxybutyl)-1,3-thiazole-4-sulfonate |
| SMILES | Nc1nc(S(=O)(=O)Oc2cc(C(F)(F)F)ccc2Cl)c(CCCCO)s1 |
| InChI | InChI=1S/C14H14ClF3N2O4S2/c15-9-5-4-8(14(16,17)18)7-10(9)24-26(22,23)12-11(3-1-2-6-21)25-13(19)20-12/h4-5,7,21H,1-3,6H2,(H2,19,20) |
| InChIKey | HNRMEYSWQDCONN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 102.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.86 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|