C14H13ClF3NOS2 — CID 154167525
4-[2-[2-chloro-5-(trifluoromethyl)phenyl]sulfanyl-1,3-thiazol-5-yl]butan-1-ol (PubChem CID 154167525) has the molecular formula C14H13ClF3NOS2 and a molecular weight of 367.85 g/mol. Its IUPAC name is 4-[2-[2-chloro-5-(trifluoromethyl)phenyl]sulfanyl-1,3-thiazol-5-yl]butan-1-ol.
| Compound Name | 4-[2-[2-chloro-5-(trifluoromethyl)phenyl]sulfanyl-1,3-thiazol-5-yl]butan-1-ol |
|---|---|
| PubChem CID | 154167525 |
| Molecular Formula | C14H13ClF3NOS2 |
| Molecular Weight | 367.85 g/mol |
| Exact Mass | 367.01 |
| IUPAC Name | 4-[2-[2-chloro-5-(trifluoromethyl)phenyl]sulfanyl-1,3-thiazol-5-yl]butan-1-ol |
| SMILES | OCCCCc1cnc(Sc2cc(C(F)(F)F)ccc2Cl)s1 |
| InChI | InChI=1S/C14H13ClF3NOS2/c15-11-5-4-9(14(16,17)18)7-12(11)22-13-19-8-10(21-13)3-1-2-6-20/h4-5,7-8,20H,1-3,6H2 |
| InChIKey | JDVJFTLDYJDRBU-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.85 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|