C8H7F2NO4S — CID 174510891
(3,4-difluorobenzenecarboximidoyl)oxymethanesulfonic acid (PubChem CID 174510891) has the molecular formula C8H7F2NO4S and a molecular weight of 251.21 g/mol. Its IUPAC name is (3,4-difluorobenzenecarboximidoyl)oxymethanesulfonic acid.
| Compound Name | (3,4-difluorobenzenecarboximidoyl)oxymethanesulfonic acid |
|---|---|
| PubChem CID | 174510891 |
| Molecular Formula | C8H7F2NO4S |
| Molecular Weight | 251.21 g/mol |
| Exact Mass | 251.01 |
| IUPAC Name | (3,4-difluorobenzenecarboximidoyl)oxymethanesulfonic acid |
| SMILES | [H]/N=C(\OCS(=O)(=O)O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C8H7F2NO4S/c9-6-2-1-5(3-7(6)10)8(11)15-4-16(12,13)14/h1-3,11H,4H2,(H,12,13,14)/b11-8- |
| InChIKey | ZLVQZVOQUBTVRB-FLIBITNWSA-N |
| XLogP | 1.15 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.21 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|