C12H16N2O5 — CID 174511333
(3S)-3-amino-4-[4-hydroxy-N-(2-hydroxyethyl)anilino]-4-oxobutanoic acid (PubChem CID 174511333) has the molecular formula C12H16N2O5 and a molecular weight of 268.27 g/mol. Its IUPAC name is (3S)-3-amino-4-[4-hydroxy-N-(2-hydroxyethyl)anilino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-amino-4-[4-hydroxy-N-(2-hydroxyethyl)anilino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 174511333 |
| Molecular Formula | C12H16N2O5 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | (3S)-3-amino-4-[4-hydroxy-N-(2-hydroxyethyl)anilino]-4-oxobutanoic acid |
| SMILES | N[C@@H](CC(=O)O)C(=O)N(CCO)c1ccc(O)cc1 |
| InChI | InChI=1S/C12H16N2O5/c13-10(7-11(17)18)12(19)14(5-6-15)8-1-3-9(16)4-2-8/h1-4,10,15-16H,5-7,13H2,(H,17,18)/t10-/m0/s1 |
| InChIKey | KCRPFESUVUKRTP-JTQLQIEISA-N |
| XLogP | -0.48 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |