C12H17N3O4 — CID 174779620
(2S)-2-amino-N-(2-hydroxyethyl)-N-(4-hydroxyphenyl)butanediamide (PubChem CID 174779620) has the molecular formula C12H17N3O4 and a molecular weight of 267.29 g/mol. Its IUPAC name is (2S)-2-amino-N-(2-hydroxyethyl)-N-(4-hydroxyphenyl)butanediamide.
| Compound Name | (2S)-2-amino-N-(2-hydroxyethyl)-N-(4-hydroxyphenyl)butanediamide |
|---|---|
| PubChem CID | 174779620 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | (2S)-2-amino-N-(2-hydroxyethyl)-N-(4-hydroxyphenyl)butanediamide |
| SMILES | NC(=O)C[C@H](N)C(=O)N(CCO)c1ccc(O)cc1 |
| InChI | InChI=1S/C12H17N3O4/c13-10(7-11(14)18)12(19)15(5-6-16)8-1-3-9(17)4-2-8/h1-4,10,16-17H,5-7,13H2,(H2,14,18)/t10-/m0/s1 |
| InChIKey | FSDDKKXQEJFCPO-JTQLQIEISA-N |
| XLogP | -1.08 |
| TPSA | 129.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |