C8H15N3O — CID 174516821
2-(1,2,4-triazol-1-yl)hexan-1-ol (PubChem CID 174516821) has the molecular formula C8H15N3O and a molecular weight of 169.23 g/mol. Its IUPAC name is 2-(1,2,4-triazol-1-yl)hexan-1-ol.
| Compound Name | 2-(1,2,4-triazol-1-yl)hexan-1-ol |
|---|---|
| PubChem CID | 174516821 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | 2-(1,2,4-triazol-1-yl)hexan-1-ol |
| SMILES | CCCCC(CO)n1cncn1 |
| InChI | InChI=1S/C8H15N3O/c1-2-3-4-8(5-12)11-7-9-6-10-11/h6-8,12H,2-5H2,1H3 |
| InChIKey | VVPNIJGTILLDLZ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |