C26H32N4O5 — CID 174517265
[[5-(2-methylphenoxy)-2-(4-phenylpiperazine-1-carbonyl)piperidine-3-carbonyl]amino] acetate (PubChem CID 174517265) has the molecular formula C26H32N4O5 and a molecular weight of 480.57 g/mol. Its IUPAC name is [[5-(2-methylphenoxy)-2-(4-phenylpiperazine-1-carbonyl)piperidine-3-carbonyl]amino] acetate.
| Compound Name | [[5-(2-methylphenoxy)-2-(4-phenylpiperazine-1-carbonyl)piperidine-3-carbonyl]amino] acetate |
|---|---|
| PubChem CID | 174517265 |
| Molecular Formula | C26H32N4O5 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | [[5-(2-methylphenoxy)-2-(4-phenylpiperazine-1-carbonyl)piperidine-3-carbonyl]amino] acetate |
| SMILES | CC(=O)ONC(=O)C1CC(Oc2ccccc2C)CNC1C(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C26H32N4O5/c1-18-8-6-7-11-23(18)34-21-16-22(25(32)28-35-19(2)31)24(27-17-21)26(33)30-14-12-29(13-15-30)20-9-4-3-5-10-20/h3-11,21-22,24,27H,12-17H2,1-2H3,(H,28,32) |
| InChIKey | XTNAVSVCHMQGLW-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|