C28H33N5O4 — CID 91312146
(2S,3S,5S)-N-hydroxy-N-methyl-5-(2-methylquinolin-4-yl)oxy-2-(4-phenylpiperazine-1-carbonyl)piperidine-3-carboxamide (PubChem CID 91312146) has the molecular formula C28H33N5O4 and a molecular weight of 503.60 g/mol. Its IUPAC name is (2S,3S,5S)-N-hydroxy-N-methyl-5-(2-methylquinolin-4-yl)oxy-2-(4-phenylpiperazine-1-carbonyl)piperidine-3-carboxamide.
| Compound Name | (2S,3S,5S)-N-hydroxy-N-methyl-5-(2-methylquinolin-4-yl)oxy-2-(4-phenylpiperazine-1-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 91312146 |
| Molecular Formula | C28H33N5O4 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | (2S,3S,5S)-N-hydroxy-N-methyl-5-(2-methylquinolin-4-yl)oxy-2-(4-phenylpiperazine-1-carbonyl)piperidine-3-carboxamide |
| SMILES | Cc1cc(O[C@@H]2CN[C@H](C(=O)N3CCN(c4ccccc4)CC3)[C@@H](C(=O)N(C)O)C2)c2ccccc2n1 |
| InChI | InChI=1S/C28H33N5O4/c1-19-16-25(22-10-6-7-11-24(22)30-19)37-21-17-23(27(34)31(2)36)26(29-18-21)28(35)33-14-12-32(13-15-33)20-8-4-3-5-9-20/h3-11,16,21,23,26,29,36H,12-15,17-18H2,1-2H3/t21-,23-,26-/m0/s1 |
| InChIKey | KUFBDQYGMIPARG-KJOQGJGQSA-N |
| XLogP | 2.47 |
| TPSA | 98.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|