C24H35N5O5 — CID 87928528
[(3S,5S,6S)-5-[2-(hydroxyamino)-2-oxoethyl]-6-(4-phenylpiperazine-1-carbonyl)piperidin-3-yl] piperidine-1-carboxylate (PubChem CID 87928528) has the molecular formula C24H35N5O5 and a molecular weight of 473.57 g/mol. Its IUPAC name is [(3S,5S,6S)-5-[2-(hydroxyamino)-2-oxoethyl]-6-(4-phenylpiperazine-1-carbonyl)piperidin-3-yl] piperidine-1-carboxylate.
| Compound Name | [(3S,5S,6S)-5-[2-(hydroxyamino)-2-oxoethyl]-6-(4-phenylpiperazine-1-carbonyl)piperidin-3-yl] piperidine-1-carboxylate |
|---|---|
| PubChem CID | 87928528 |
| Molecular Formula | C24H35N5O5 |
| Molecular Weight | 473.57 g/mol |
| Exact Mass | 473.26 |
| IUPAC Name | [(3S,5S,6S)-5-[2-(hydroxyamino)-2-oxoethyl]-6-(4-phenylpiperazine-1-carbonyl)piperidin-3-yl] piperidine-1-carboxylate |
| SMILES | O=C(C[C@@H]1C[C@H](OC(=O)N2CCCCC2)CN[C@@H]1C(=O)N1CCN(c2ccccc2)CC1)NO |
| InChI | InChI=1S/C24H35N5O5/c30-21(26-33)16-18-15-20(34-24(32)29-9-5-2-6-10-29)17-25-22(18)23(31)28-13-11-27(12-14-28)19-7-3-1-4-8-19/h1,3-4,7-8,18,20,22,25,33H,2,5-6,9-17H2,(H,26,30)/t18-,20-,22-/m0/s1 |
| InChIKey | DJYLAINGFJQOQM-VCOUNFBDSA-N |
| XLogP | 1.20 |
| TPSA | 114.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.57 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|