C24H33N5O7 — CID 87530082
(2S,3S,5S)-3-(hydroxycarbamoyl)-2-(4-phenylpiperazine-1-carbonyl)-5-(piperidine-1-carbonyloxy)piperidine-1-carboxylic acid (PubChem CID 87530082) has the molecular formula C24H33N5O7 and a molecular weight of 503.56 g/mol. Its IUPAC name is (2S,3S,5S)-3-(hydroxycarbamoyl)-2-(4-phenylpiperazine-1-carbonyl)-5-(piperidine-1-carbonyloxy)piperidine-1-carboxylic acid.
| Compound Name | (2S,3S,5S)-3-(hydroxycarbamoyl)-2-(4-phenylpiperazine-1-carbonyl)-5-(piperidine-1-carbonyloxy)piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 87530082 |
| Molecular Formula | C24H33N5O7 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | (2S,3S,5S)-3-(hydroxycarbamoyl)-2-(4-phenylpiperazine-1-carbonyl)-5-(piperidine-1-carbonyloxy)piperidine-1-carboxylic acid |
| SMILES | O=C(NO)[C@H]1C[C@H](OC(=O)N2CCCCC2)CN(C(=O)O)[C@@H]1C(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H33N5O7/c30-21(25-35)19-15-18(36-24(34)28-9-5-2-6-10-28)16-29(23(32)33)20(19)22(31)27-13-11-26(12-14-27)17-7-3-1-4-8-17/h1,3-4,7-8,18-20,35H,2,5-6,9-16H2,(H,25,30)(H,32,33)/t18-,19-,20-/m0/s1 |
| InChIKey | AZUWRPVJOZJSTH-UFYCRDLUSA-N |
| XLogP | 1.20 |
| TPSA | 142.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|