C21H28N4O5 — CID 87078370
(6S,7S)-7-(hydroxycarbamoyl)-2-methyl-6-(4-phenylpiperazine-1-carbonyl)-5-azaspiro[2.5]octane-5-carboxylic acid (PubChem CID 87078370) has the molecular formula C21H28N4O5 and a molecular weight of 416.48 g/mol. Its IUPAC name is (6S,7S)-7-(hydroxycarbamoyl)-2-methyl-6-(4-phenylpiperazine-1-carbonyl)-5-azaspiro[2.5]octane-5-carboxylic acid.
| Compound Name | (6S,7S)-7-(hydroxycarbamoyl)-2-methyl-6-(4-phenylpiperazine-1-carbonyl)-5-azaspiro[2.5]octane-5-carboxylic acid |
|---|---|
| PubChem CID | 87078370 |
| Molecular Formula | C21H28N4O5 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | (6S,7S)-7-(hydroxycarbamoyl)-2-methyl-6-(4-phenylpiperazine-1-carbonyl)-5-azaspiro[2.5]octane-5-carboxylic acid |
| SMILES | CC1CC12C[C@H](C(=O)NO)[C@@H](C(=O)N1CCN(c3ccccc3)CC1)N(C(=O)O)C2 |
| InChI | InChI=1S/C21H28N4O5/c1-14-11-21(14)12-16(18(26)22-30)17(25(13-21)20(28)29)19(27)24-9-7-23(8-10-24)15-5-3-2-4-6-15/h2-6,14,16-17,30H,7-13H2,1H3,(H,22,26)(H,28,29)/t14?,16-,17-,21?/m0/s1 |
| InChIKey | HFJNSBNWLJHETF-ZZUNWWICSA-N |
| XLogP | 1.24 |
| TPSA | 113.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|