C24H32N4O6 — CID 87234325
(3R,6S,7S)-7-(hydroxycarbamoyl)-2-(oxolan-3-yl)-6-(4-phenylpiperazine-1-carbonyl)-5-azaspiro[2.5]octane-5-carboxylic acid (PubChem CID 87234325) has the molecular formula C24H32N4O6 and a molecular weight of 472.54 g/mol. Its IUPAC name is (3R,6S,7S)-7-(hydroxycarbamoyl)-2-(oxolan-3-yl)-6-(4-phenylpiperazine-1-carbonyl)-5-azaspiro[2.5]octane-5-carboxylic acid.
| Compound Name | (3R,6S,7S)-7-(hydroxycarbamoyl)-2-(oxolan-3-yl)-6-(4-phenylpiperazine-1-carbonyl)-5-azaspiro[2.5]octane-5-carboxylic acid |
|---|---|
| PubChem CID | 87234325 |
| Molecular Formula | C24H32N4O6 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | (3R,6S,7S)-7-(hydroxycarbamoyl)-2-(oxolan-3-yl)-6-(4-phenylpiperazine-1-carbonyl)-5-azaspiro[2.5]octane-5-carboxylic acid |
| SMILES | O=C(NO)[C@H]1C[C@@]2(CC2C2CCOC2)CN(C(=O)O)[C@@H]1C(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H32N4O6/c29-21(25-33)18-12-24(13-19(24)16-6-11-34-14-16)15-28(23(31)32)20(18)22(30)27-9-7-26(8-10-27)17-4-2-1-3-5-17/h1-5,16,18-20,33H,6-15H2,(H,25,29)(H,31,32)/t16?,18-,19?,20-,24+/m0/s1 |
| InChIKey | JYQUZOTVTDXPBO-FWIZJQTHSA-N |
| XLogP | 1.25 |
| TPSA | 122.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|