C24H31N3O5 — CID 87234755
(6S,7S)-7-(hydroxycarbamoyl)-6-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)-2-propan-2-yl-5-azaspiro[2.5]octane-5-carboxylic acid (PubChem CID 87234755) has the molecular formula C24H31N3O5 and a molecular weight of 441.53 g/mol. Its IUPAC name is (6S,7S)-7-(hydroxycarbamoyl)-6-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)-2-propan-2-yl-5-azaspiro[2.5]octane-5-carboxylic acid.
| Compound Name | (6S,7S)-7-(hydroxycarbamoyl)-6-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)-2-propan-2-yl-5-azaspiro[2.5]octane-5-carboxylic acid |
|---|---|
| PubChem CID | 87234755 |
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | (6S,7S)-7-(hydroxycarbamoyl)-6-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)-2-propan-2-yl-5-azaspiro[2.5]octane-5-carboxylic acid |
| SMILES | CC(C)C1CC12C[C@H](C(=O)NO)[C@@H](C(=O)N1CC=C(c3ccccc3)CC1)N(C(=O)O)C2 |
| InChI | InChI=1S/C24H31N3O5/c1-15(2)19-13-24(19)12-18(21(28)25-32)20(27(14-24)23(30)31)22(29)26-10-8-17(9-11-26)16-6-4-3-5-7-16/h3-8,15,18-20,32H,9-14H2,1-2H3,(H,25,28)(H,30,31)/t18-,19?,20-,24?/m0/s1 |
| InChIKey | DBWRVLCNCMYPAK-FKOHWTJXSA-N |
| XLogP | 2.84 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|