C26H33N3O5 — CID 87234517
cyclohexyl (6S,7S)-7-(hydroxycarbamoyl)-6-(3-phenyl-2,5-dihydropyrrole-1-carbonyl)-5-azaspiro[2.5]octane-5-carboxylate (PubChem CID 87234517) has the molecular formula C26H33N3O5 and a molecular weight of 467.57 g/mol. Its IUPAC name is cyclohexyl (6S,7S)-7-(hydroxycarbamoyl)-6-(3-phenyl-2,5-dihydropyrrole-1-carbonyl)-5-azaspiro[2.5]octane-5-carboxylate.
| Compound Name | cyclohexyl (6S,7S)-7-(hydroxycarbamoyl)-6-(3-phenyl-2,5-dihydropyrrole-1-carbonyl)-5-azaspiro[2.5]octane-5-carboxylate |
|---|---|
| PubChem CID | 87234517 |
| Molecular Formula | C26H33N3O5 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | cyclohexyl (6S,7S)-7-(hydroxycarbamoyl)-6-(3-phenyl-2,5-dihydropyrrole-1-carbonyl)-5-azaspiro[2.5]octane-5-carboxylate |
| SMILES | O=C(NO)[C@H]1CC2(CC2)CN(C(=O)OC2CCCCC2)[C@@H]1C(=O)N1CC=C(c2ccccc2)C1 |
| InChI | InChI=1S/C26H33N3O5/c30-23(27-33)21-15-26(12-13-26)17-29(25(32)34-20-9-5-2-6-10-20)22(21)24(31)28-14-11-19(16-28)18-7-3-1-4-8-18/h1,3-4,7-8,11,20-22,33H,2,5-6,9-10,12-17H2,(H,27,30)/t21-,22-/m0/s1 |
| InChIKey | INSQCIDUYXPXLS-VXKWHMMOSA-N |
| XLogP | 3.36 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|