C23H29N3O5 — CID 87768169
ethyl 7-(hydroxycarbamoyl)-6-(4-phenyl-1,2,3,6-tetrahydropyridine-2-carbonyl)-5-azaspiro[2.5]octane-5-carboxylate (PubChem CID 87768169) has the molecular formula C23H29N3O5 and a molecular weight of 427.50 g/mol. Its IUPAC name is ethyl 7-(hydroxycarbamoyl)-6-(4-phenyl-1,2,3,6-tetrahydropyridine-2-carbonyl)-5-azaspiro[2.5]octane-5-carboxylate.
| Compound Name | ethyl 7-(hydroxycarbamoyl)-6-(4-phenyl-1,2,3,6-tetrahydropyridine-2-carbonyl)-5-azaspiro[2.5]octane-5-carboxylate |
|---|---|
| PubChem CID | 87768169 |
| Molecular Formula | C23H29N3O5 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | ethyl 7-(hydroxycarbamoyl)-6-(4-phenyl-1,2,3,6-tetrahydropyridine-2-carbonyl)-5-azaspiro[2.5]octane-5-carboxylate |
| SMILES | CCOC(=O)N1CC2(CC2)CC(C(=O)NO)C1C(=O)C1CC(c2ccccc2)=CCN1 |
| InChI | InChI=1S/C23H29N3O5/c1-2-31-22(29)26-14-23(9-10-23)13-17(21(28)25-30)19(26)20(27)18-12-16(8-11-24-18)15-6-4-3-5-7-15/h3-8,17-19,24,30H,2,9-14H2,1H3,(H,25,28) |
| InChIKey | OOIDFKWLPPNZDE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|