C23H29N3O6 — CID 118536391
ethyl [7-(hydroxycarbamoyl)-6-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)-5-azaspiro[2.5]octan-5-yl] carbonate (PubChem CID 118536391) has the molecular formula C23H29N3O6 and a molecular weight of 443.50 g/mol. Its IUPAC name is ethyl [7-(hydroxycarbamoyl)-6-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)-5-azaspiro[2.5]octan-5-yl] carbonate.
| Compound Name | ethyl [7-(hydroxycarbamoyl)-6-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)-5-azaspiro[2.5]octan-5-yl] carbonate |
|---|---|
| PubChem CID | 118536391 |
| Molecular Formula | C23H29N3O6 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | ethyl [7-(hydroxycarbamoyl)-6-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)-5-azaspiro[2.5]octan-5-yl] carbonate |
| SMILES | CCOC(=O)ON1CC2(CC2)CC(C(=O)NO)C1C(=O)N1CC=C(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H29N3O6/c1-2-31-22(29)32-26-15-23(10-11-23)14-18(20(27)24-30)19(26)21(28)25-12-8-17(9-13-25)16-6-4-3-5-7-16/h3-8,18-19,30H,2,9-15H2,1H3,(H,24,27) |
| InChIKey | ROXWASCPZUCVJC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|