C26H36N4O5 — CID 87349142
[(3S,5S,6S)-5-(hydroxycarbamoyl)-1-methyl-6-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)piperidin-3-yl] azepane-1-carboxylate (PubChem CID 87349142) has the molecular formula C26H36N4O5 and a molecular weight of 484.60 g/mol. Its IUPAC name is [(3S,5S,6S)-5-(hydroxycarbamoyl)-1-methyl-6-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)piperidin-3-yl] azepane-1-carboxylate.
| Compound Name | [(3S,5S,6S)-5-(hydroxycarbamoyl)-1-methyl-6-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)piperidin-3-yl] azepane-1-carboxylate |
|---|---|
| PubChem CID | 87349142 |
| Molecular Formula | C26H36N4O5 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | [(3S,5S,6S)-5-(hydroxycarbamoyl)-1-methyl-6-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)piperidin-3-yl] azepane-1-carboxylate |
| SMILES | CN1C[C@@H](OC(=O)N2CCCCCC2)C[C@H](C(=O)NO)[C@H]1C(=O)N1CC=C(c2ccccc2)CC1 |
| InChI | InChI=1S/C26H36N4O5/c1-28-18-21(35-26(33)30-13-7-2-3-8-14-30)17-22(24(31)27-34)23(28)25(32)29-15-11-20(12-16-29)19-9-5-4-6-10-19/h4-6,9-11,21-23,34H,2-3,7-8,12-18H2,1H3,(H,27,31)/t21-,22-,23-/m0/s1 |
| InChIKey | ARBXATJAGAKEBB-VABKMULXSA-N |
| XLogP | 2.51 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|