C23H26N4O4 — CID 87348598
(2S,3S,5S)-N-hydroxy-1-methyl-2-(3-phenyl-2,5-dihydropyrrole-1-carbonyl)-5-pyridin-4-yloxypiperidine-3-carboxamide (PubChem CID 87348598) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is (2S,3S,5S)-N-hydroxy-1-methyl-2-(3-phenyl-2,5-dihydropyrrole-1-carbonyl)-5-pyridin-4-yloxypiperidine-3-carboxamide.
| Compound Name | (2S,3S,5S)-N-hydroxy-1-methyl-2-(3-phenyl-2,5-dihydropyrrole-1-carbonyl)-5-pyridin-4-yloxypiperidine-3-carboxamide |
|---|---|
| PubChem CID | 87348598 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | (2S,3S,5S)-N-hydroxy-1-methyl-2-(3-phenyl-2,5-dihydropyrrole-1-carbonyl)-5-pyridin-4-yloxypiperidine-3-carboxamide |
| SMILES | CN1C[C@@H](Oc2ccncc2)C[C@H](C(=O)NO)[C@H]1C(=O)N1CC=C(c2ccccc2)C1 |
| InChI | InChI=1S/C23H26N4O4/c1-26-15-19(31-18-7-10-24-11-8-18)13-20(22(28)25-30)21(26)23(29)27-12-9-17(14-27)16-5-3-2-4-6-16/h2-11,19-21,30H,12-15H2,1H3,(H,25,28)/t19-,20-,21-/m0/s1 |
| InChIKey | TWMWMDBFDPZREI-ACRUOGEOSA-N |
| XLogP | 1.58 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|