C24H28F2N4O4 — CID 87870555
5-(3,4-difluorophenoxy)-N-hydroxy-1-methyl-2-(4-phenylpiperazine-1-carbonyl)piperidine-3-carboxamide (PubChem CID 87870555) has the molecular formula C24H28F2N4O4 and a molecular weight of 474.51 g/mol. Its IUPAC name is 5-(3,4-difluorophenoxy)-N-hydroxy-1-methyl-2-(4-phenylpiperazine-1-carbonyl)piperidine-3-carboxamide.
| Compound Name | 5-(3,4-difluorophenoxy)-N-hydroxy-1-methyl-2-(4-phenylpiperazine-1-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 87870555 |
| Molecular Formula | C24H28F2N4O4 |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 5-(3,4-difluorophenoxy)-N-hydroxy-1-methyl-2-(4-phenylpiperazine-1-carbonyl)piperidine-3-carboxamide |
| SMILES | CN1CC(Oc2ccc(F)c(F)c2)CC(C(=O)NO)C1C(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H28F2N4O4/c1-28-15-18(34-17-7-8-20(25)21(26)14-17)13-19(23(31)27-33)22(28)24(32)30-11-9-29(10-12-30)16-5-3-2-4-6-16/h2-8,14,18-19,22,33H,9-13,15H2,1H3,(H,27,31) |
| InChIKey | LFUBFUNCGQLJKW-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|