C24H28ClN3O4 — CID 91507292
5-(3-chlorophenoxy)-N-hydroxy-2-(4-phenylpiperazine-1-carbonyl)cyclohexane-1-carboxamide (PubChem CID 91507292) has the molecular formula C24H28ClN3O4 and a molecular weight of 457.96 g/mol. Its IUPAC name is 5-(3-chlorophenoxy)-N-hydroxy-2-(4-phenylpiperazine-1-carbonyl)cyclohexane-1-carboxamide.
| Compound Name | 5-(3-chlorophenoxy)-N-hydroxy-2-(4-phenylpiperazine-1-carbonyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 91507292 |
| Molecular Formula | C24H28ClN3O4 |
| Molecular Weight | 457.96 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 5-(3-chlorophenoxy)-N-hydroxy-2-(4-phenylpiperazine-1-carbonyl)cyclohexane-1-carboxamide |
| SMILES | O=C(NO)C1CC(Oc2cccc(Cl)c2)CCC1C(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H28ClN3O4/c25-17-5-4-8-19(15-17)32-20-9-10-21(22(16-20)23(29)26-31)24(30)28-13-11-27(12-14-28)18-6-2-1-3-7-18/h1-8,15,20-22,31H,9-14,16H2,(H,26,29) |
| InChIKey | JIUGAWKJUAFMQF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.96 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|