C25H36N4O6 — CID 87348641
methyl 4-[(1R,3S,4S)-3-(hydroxycarbamoyl)-4-(4-phenylpiperazine-1-carbonyl)cyclohexyl]oxypiperidine-1-carboxylate (PubChem CID 87348641) has the molecular formula C25H36N4O6 and a molecular weight of 488.59 g/mol. Its IUPAC name is methyl 4-[(1R,3S,4S)-3-(hydroxycarbamoyl)-4-(4-phenylpiperazine-1-carbonyl)cyclohexyl]oxypiperidine-1-carboxylate.
| Compound Name | methyl 4-[(1R,3S,4S)-3-(hydroxycarbamoyl)-4-(4-phenylpiperazine-1-carbonyl)cyclohexyl]oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 87348641 |
| Molecular Formula | C25H36N4O6 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.26 |
| IUPAC Name | methyl 4-[(1R,3S,4S)-3-(hydroxycarbamoyl)-4-(4-phenylpiperazine-1-carbonyl)cyclohexyl]oxypiperidine-1-carboxylate |
| SMILES | COC(=O)N1CCC(O[C@@H]2CC[C@H](C(=O)N3CCN(c4ccccc4)CC3)[C@@H](C(=O)NO)C2)CC1 |
| InChI | InChI=1S/C25H36N4O6/c1-34-25(32)29-11-9-19(10-12-29)35-20-7-8-21(22(17-20)23(30)26-33)24(31)28-15-13-27(14-16-28)18-5-3-2-4-6-18/h2-6,19-22,33H,7-17H2,1H3,(H,26,30)/t20-,21+,22+/m1/s1 |
| InChIKey | WSWPHECOKOAOMH-FSSWDIPSSA-N |
| XLogP | 1.87 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|