C27H32N4O5 — CID 87348446
[(1R,3S,4S)-3-(hydroxycarbamoyl)-4-(4-phenylpiperazine-1-carbonyl)cyclohexyl] 2,3-dihydroindole-1-carboxylate (PubChem CID 87348446) has the molecular formula C27H32N4O5 and a molecular weight of 492.58 g/mol. Its IUPAC name is [(1R,3S,4S)-3-(hydroxycarbamoyl)-4-(4-phenylpiperazine-1-carbonyl)cyclohexyl] 2,3-dihydroindole-1-carboxylate.
| Compound Name | [(1R,3S,4S)-3-(hydroxycarbamoyl)-4-(4-phenylpiperazine-1-carbonyl)cyclohexyl] 2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 87348446 |
| Molecular Formula | C27H32N4O5 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | [(1R,3S,4S)-3-(hydroxycarbamoyl)-4-(4-phenylpiperazine-1-carbonyl)cyclohexyl] 2,3-dihydroindole-1-carboxylate |
| SMILES | O=C(NO)[C@H]1C[C@H](OC(=O)N2CCc3ccccc32)CC[C@@H]1C(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C27H32N4O5/c32-25(28-35)23-18-21(36-27(34)31-13-12-19-6-4-5-9-24(19)31)10-11-22(23)26(33)30-16-14-29(15-17-30)20-7-2-1-3-8-20/h1-9,21-23,35H,10-18H2,(H,28,32)/t21-,22+,23+/m1/s1 |
| InChIKey | QPFMQTZTOCIGJA-VJBWXMMDSA-N |
| XLogP | 2.82 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|