C23H31N5O7 — CID 87530277
(2S,3S)-3-(hydroxycarbamoyl)-2-(4-phenylpiperazine-1-carbonyl)-5-(pyrrolidine-1-carbonyloxy)piperidine-1-carboxylic acid (PubChem CID 87530277) has the molecular formula C23H31N5O7 and a molecular weight of 489.53 g/mol. Its IUPAC name is (2S,3S)-3-(hydroxycarbamoyl)-2-(4-phenylpiperazine-1-carbonyl)-5-(pyrrolidine-1-carbonyloxy)piperidine-1-carboxylic acid.
| Compound Name | (2S,3S)-3-(hydroxycarbamoyl)-2-(4-phenylpiperazine-1-carbonyl)-5-(pyrrolidine-1-carbonyloxy)piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 87530277 |
| Molecular Formula | C23H31N5O7 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | (2S,3S)-3-(hydroxycarbamoyl)-2-(4-phenylpiperazine-1-carbonyl)-5-(pyrrolidine-1-carbonyloxy)piperidine-1-carboxylic acid |
| SMILES | O=C(NO)[C@H]1CC(OC(=O)N2CCCC2)CN(C(=O)O)[C@@H]1C(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H31N5O7/c29-20(24-34)18-14-17(35-23(33)27-8-4-5-9-27)15-28(22(31)32)19(18)21(30)26-12-10-25(11-13-26)16-6-2-1-3-7-16/h1-3,6-7,17-19,34H,4-5,8-15H2,(H,24,29)(H,31,32)/t17?,18-,19-/m0/s1 |
| InChIKey | ULSSRBZDASFROF-MNNMKWMVSA-N |
| XLogP | 0.81 |
| TPSA | 142.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|