C24H29N5O6 — CID 87530114
(2S,3S,5S)-3-(hydroxycarbamoyl)-5-[(4-methyl-2-pyridinyl)oxy]-2-(4-phenylpiperazine-1-carbonyl)piperidine-1-carboxylic acid (PubChem CID 87530114) has the molecular formula C24H29N5O6 and a molecular weight of 483.53 g/mol. Its IUPAC name is (2S,3S,5S)-3-(hydroxycarbamoyl)-5-[(4-methyl-2-pyridinyl)oxy]-2-(4-phenylpiperazine-1-carbonyl)piperidine-1-carboxylic acid.
| Compound Name | (2S,3S,5S)-3-(hydroxycarbamoyl)-5-[(4-methyl-2-pyridinyl)oxy]-2-(4-phenylpiperazine-1-carbonyl)piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 87530114 |
| Molecular Formula | C24H29N5O6 |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | (2S,3S,5S)-3-(hydroxycarbamoyl)-5-[(4-methyl-2-pyridinyl)oxy]-2-(4-phenylpiperazine-1-carbonyl)piperidine-1-carboxylic acid |
| SMILES | Cc1ccnc(O[C@H]2C[C@H](C(=O)NO)[C@@H](C(=O)N3CCN(c4ccccc4)CC3)N(C(=O)O)C2)c1 |
| InChI | InChI=1S/C24H29N5O6/c1-16-7-8-25-20(13-16)35-18-14-19(22(30)26-34)21(29(15-18)24(32)33)23(31)28-11-9-27(10-12-28)17-5-3-2-4-6-17/h2-8,13,18-19,21,34H,9-12,14-15H2,1H3,(H,26,30)(H,32,33)/t18-,19-,21-/m0/s1 |
| InChIKey | UNCIUVFOBSRNIN-ZJOUEHCJSA-N |
| XLogP | 1.36 |
| TPSA | 135.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|