C23H28N4O4 — CID 87349458
(1S,2S,5R)-N-hydroxy-2-(4-phenylpiperazine-1-carbonyl)-5-pyridin-2-yloxycyclohexane-1-carboxamide (PubChem CID 87349458) has the molecular formula C23H28N4O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is (1S,2S,5R)-N-hydroxy-2-(4-phenylpiperazine-1-carbonyl)-5-pyridin-2-yloxycyclohexane-1-carboxamide.
| Compound Name | (1S,2S,5R)-N-hydroxy-2-(4-phenylpiperazine-1-carbonyl)-5-pyridin-2-yloxycyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 87349458 |
| Molecular Formula | C23H28N4O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | (1S,2S,5R)-N-hydroxy-2-(4-phenylpiperazine-1-carbonyl)-5-pyridin-2-yloxycyclohexane-1-carboxamide |
| SMILES | O=C(NO)[C@H]1C[C@H](Oc2ccccn2)CC[C@@H]1C(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H28N4O4/c28-22(25-30)20-16-18(31-21-8-4-5-11-24-21)9-10-19(20)23(29)27-14-12-26(13-15-27)17-6-2-1-3-7-17/h1-8,11,18-20,30H,9-10,12-16H2,(H,25,28)/t18-,19+,20+/m1/s1 |
| InChIKey | RSZYJTZUEQUELX-AABGKKOBSA-N |
| XLogP | 2.10 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|