C25H29ClN4O6 — CID 87348365
methyl (2S,3S,5S)-5-(3-chlorophenoxy)-3-(hydroxycarbamoyl)-2-(4-phenylpiperazine-1-carbonyl)piperidine-1-carboxylate (PubChem CID 87348365) has the molecular formula C25H29ClN4O6 and a molecular weight of 516.98 g/mol. Its IUPAC name is methyl (2S,3S,5S)-5-(3-chlorophenoxy)-3-(hydroxycarbamoyl)-2-(4-phenylpiperazine-1-carbonyl)piperidine-1-carboxylate.
| Compound Name | methyl (2S,3S,5S)-5-(3-chlorophenoxy)-3-(hydroxycarbamoyl)-2-(4-phenylpiperazine-1-carbonyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 87348365 |
| Molecular Formula | C25H29ClN4O6 |
| Molecular Weight | 516.98 g/mol |
| Exact Mass | 516.18 |
| IUPAC Name | methyl (2S,3S,5S)-5-(3-chlorophenoxy)-3-(hydroxycarbamoyl)-2-(4-phenylpiperazine-1-carbonyl)piperidine-1-carboxylate |
| SMILES | COC(=O)N1C[C@@H](Oc2cccc(Cl)c2)C[C@H](C(=O)NO)[C@H]1C(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C25H29ClN4O6/c1-35-25(33)30-16-20(36-19-9-5-6-17(26)14-19)15-21(23(31)27-34)22(30)24(32)29-12-10-28(11-13-29)18-7-3-2-4-8-18/h2-9,14,20-22,34H,10-13,15-16H2,1H3,(H,27,31)/t20-,21-,22-/m0/s1 |
| InChIKey | OQPJNMIVFBSDDX-FKBYEOEOSA-N |
| XLogP | 2.40 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.98 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|