C24H31N3O6 — CID 87348584
[(1S,3S,4S)-3-(hydroxycarbamoyl)-4-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)cyclohexyl] morpholine-4-carboxylate (PubChem CID 87348584) has the molecular formula C24H31N3O6 and a molecular weight of 457.53 g/mol. Its IUPAC name is [(1S,3S,4S)-3-(hydroxycarbamoyl)-4-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)cyclohexyl] morpholine-4-carboxylate.
| Compound Name | [(1S,3S,4S)-3-(hydroxycarbamoyl)-4-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)cyclohexyl] morpholine-4-carboxylate |
|---|---|
| PubChem CID | 87348584 |
| Molecular Formula | C24H31N3O6 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | [(1S,3S,4S)-3-(hydroxycarbamoyl)-4-(4-phenyl-3,6-dihydro-2H-pyridine-1-carbonyl)cyclohexyl] morpholine-4-carboxylate |
| SMILES | O=C(NO)[C@H]1C[C@@H](OC(=O)N2CCOCC2)CC[C@@H]1C(=O)N1CC=C(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H31N3O6/c28-22(25-31)21-16-19(33-24(30)27-12-14-32-15-13-27)6-7-20(21)23(29)26-10-8-18(9-11-26)17-4-2-1-3-5-17/h1-5,8,19-21,31H,6-7,9-16H2,(H,25,28)/t19-,20-,21-/m0/s1 |
| InChIKey | JCNZASHPAHLPTF-ACRUOGEOSA-N |
| XLogP | 2.06 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|