C24H32N4O6 — CID 87234317
[(3R)-oxolan-3-yl] 7-(hydroxycarbamoyl)-6-(4-phenylpiperazine-1-carbonyl)-5-azaspiro[2.5]octane-5-carboxylate (PubChem CID 87234317) has the molecular formula C24H32N4O6 and a molecular weight of 472.54 g/mol. Its IUPAC name is [(3R)-oxolan-3-yl] 7-(hydroxycarbamoyl)-6-(4-phenylpiperazine-1-carbonyl)-5-azaspiro[2.5]octane-5-carboxylate.
| Compound Name | [(3R)-oxolan-3-yl] 7-(hydroxycarbamoyl)-6-(4-phenylpiperazine-1-carbonyl)-5-azaspiro[2.5]octane-5-carboxylate |
|---|---|
| PubChem CID | 87234317 |
| Molecular Formula | C24H32N4O6 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | [(3R)-oxolan-3-yl] 7-(hydroxycarbamoyl)-6-(4-phenylpiperazine-1-carbonyl)-5-azaspiro[2.5]octane-5-carboxylate |
| SMILES | O=C(NO)C1CC2(CC2)CN(C(=O)O[C@@H]2CCOC2)C1C(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H32N4O6/c29-21(25-32)19-14-24(7-8-24)16-28(23(31)34-18-6-13-33-15-18)20(19)22(30)27-11-9-26(10-12-27)17-4-2-1-3-5-17/h1-5,18-20,32H,6-16H2,(H,25,29)/t18-,19?,20?/m1/s1 |
| InChIKey | KZMZXWVOUIOSBN-XEVCZEQESA-N |
| XLogP | 1.24 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|