About 4-(4-methylpyrrolo[2,3-d][1,3]oxazol-2-yl)phenol
4-(4-methylpyrrolo[2,3-d][1,3]oxazol-2-yl)phenol (PubChem CID 174517868) has the molecular formula C12H10N2O2
and a molecular weight of 214.22 g/mol. Its IUPAC name is 4-(4-methylpyrrolo[2,3-d][1,3]oxazol-2-yl)phenol.
Molecular Properties
| Compound Name | 4-(4-methylpyrrolo[2,3-d][1,3]oxazol-2-yl)phenol |
| PubChem CID | 174517868 |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 4-(4-methylpyrrolo[2,3-d][1,3]oxazol-2-yl)phenol |
| SMILES | Cn1ccc2oc(-c3ccc(O)cc3)nc21 |
| InChI | InChI=1S/C12H10N2O2/c1-14-7-6-10-11(14)13-12(16-10)8-2-4-9(15)5-3-8/h2-7,15H,1H3 |
| InChIKey | MAFCLRXHAYCONX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(4-methylpyrrolo[2,3-d][1,3]oxazol-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methylpyrrolo[2,3-d][1,3]oxazol-2-yl)phenol?
The IUPAC name of 4-(4-methylpyrrolo[2,3-d][1,3]oxazol-2-yl)phenol (CID 174517868) is 4-(4-methylpyrrolo[2,3-d][1,3]oxazol-2-yl)phenol.
What is the SMILES notation for 4-(4-methylpyrrolo[2,3-d][1,3]oxazol-2-yl)phenol?
The canonical SMILES for 4-(4-methylpyrrolo[2,3-d][1,3]oxazol-2-yl)phenol is Cn1ccc2oc(-c3ccc(O)cc3)nc21.
What is the InChIKey of 4-(4-methylpyrrolo[2,3-d][1,3]oxazol-2-yl)phenol?
The InChIKey is MAFCLRXHAYCONX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O2/c1-14-7-6-10-11(14)13-12(16-10)8-2-4-9(15)5-3-8/h2-7,15H,1H3.
What are the key properties of 4-(4-methylpyrrolo[2,3-d][1,3]oxazol-2-yl)phenol?
4-(4-methylpyrrolo[2,3-d][1,3]oxazol-2-yl)phenol has a molecular weight of 214.22 g/mol, XLogP of 2.54, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methylpyrrolo[2,3-d][1,3]oxazol-2-yl)phenol is sourced from PubChem (CID 174517868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).