C20H18Cl2N2O2 — CID 174519473
4-[1-(2-chlorophenyl)-3-(3-chlorophenyl)prop-2-ynyl]piperazine-1-carboxylic acid (PubChem CID 174519473) has the molecular formula C20H18Cl2N2O2 and a molecular weight of 389.28 g/mol. Its IUPAC name is 4-[1-(2-chlorophenyl)-3-(3-chlorophenyl)prop-2-ynyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[1-(2-chlorophenyl)-3-(3-chlorophenyl)prop-2-ynyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 174519473 |
| Molecular Formula | C20H18Cl2N2O2 |
| Molecular Weight | 389.28 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | 4-[1-(2-chlorophenyl)-3-(3-chlorophenyl)prop-2-ynyl]piperazine-1-carboxylic acid |
| SMILES | O=C(O)N1CCN(C(C#Cc2cccc(Cl)c2)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C20H18Cl2N2O2/c21-16-5-3-4-15(14-16)8-9-19(17-6-1-2-7-18(17)22)23-10-12-24(13-11-23)20(25)26/h1-7,14,19H,10-13H2,(H,25,26) |
| InChIKey | GWXCRESGDXJJLL-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.28 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|