About [3,5-bis(hydroxymethyl)-1,3,5-triazinan-1-yl]methanol;hydron
[3,5-bis(hydroxymethyl)-1,3,5-triazinan-1-yl]methanol;hydron (PubChem CID 174522874) has the molecular formula C6H16N3O3+
and a molecular weight of 178.21 g/mol. Its IUPAC name is [3,5-bis(hydroxymethyl)-1,3,5-triazinan-1-yl]methanol;hydron.
Molecular Properties
| Compound Name | [3,5-bis(hydroxymethyl)-1,3,5-triazinan-1-yl]methanol;hydron |
| PubChem CID | 174522874 |
| Molecular Formula | C6H16N3O3+ |
| Molecular Weight | 178.21 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | [3,5-bis(hydroxymethyl)-1,3,5-triazinan-1-yl]methanol;hydron |
| SMILES | OCN1CN(CO)CN(CO)C1.[H+] |
| InChI | InChI=1S/C6H15N3O3/c10-4-7-1-8(5-11)3-9(2-7)6-12/h10-12H,1-6H2/p+1 |
| InChIKey | VLGJRAODDPWBTI-UHFFFAOYSA-O |
| XLogP | -2.26 |
| TPSA | 70.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.21 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [3,5-bis(hydroxymethyl)-1,3,5-triazinan-1-yl]methanol;hydron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5-bis(hydroxymethyl)-1,3,5-triazinan-1-yl]methanol;hydron?
The IUPAC name of [3,5-bis(hydroxymethyl)-1,3,5-triazinan-1-yl]methanol;hydron (CID 174522874) is [3,5-bis(hydroxymethyl)-1,3,5-triazinan-1-yl]methanol;hydron.
What is the SMILES notation for [3,5-bis(hydroxymethyl)-1,3,5-triazinan-1-yl]methanol;hydron?
The canonical SMILES for [3,5-bis(hydroxymethyl)-1,3,5-triazinan-1-yl]methanol;hydron is OCN1CN(CO)CN(CO)C1.[H+].
What is the InChIKey of [3,5-bis(hydroxymethyl)-1,3,5-triazinan-1-yl]methanol;hydron?
The InChIKey is VLGJRAODDPWBTI-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H15N3O3/c10-4-7-1-8(5-11)3-9(2-7)6-12/h10-12H,1-6H2/p+1.
What are the key properties of [3,5-bis(hydroxymethyl)-1,3,5-triazinan-1-yl]methanol;hydron?
[3,5-bis(hydroxymethyl)-1,3,5-triazinan-1-yl]methanol;hydron has a molecular weight of 178.21 g/mol, XLogP of -2.26, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5-bis(hydroxymethyl)-1,3,5-triazinan-1-yl]methanol;hydron is sourced from PubChem (CID 174522874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).