C5H12N2O2 — CID 166765421
3,5-dimethyl-1,3,5-oxadiazinan-4-ol (PubChem CID 166765421) has the molecular formula C5H12N2O2 and a molecular weight of 132.16 g/mol. Its IUPAC name is 3,5-dimethyl-1,3,5-oxadiazinan-4-ol.
| Compound Name | 3,5-dimethyl-1,3,5-oxadiazinan-4-ol |
|---|---|
| PubChem CID | 166765421 |
| Molecular Formula | C5H12N2O2 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.09 |
| IUPAC Name | 3,5-dimethyl-1,3,5-oxadiazinan-4-ol |
| SMILES | CN1COCN(C)C1O |
| InChI | InChI=1S/C5H12N2O2/c1-6-3-9-4-7(2)5(6)8/h5,8H,3-4H2,1-2H3 |
| InChIKey | DTMRZXFIAUNZRF-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |