C7H16N2O3 — CID 67624248
3,5-bis(methoxymethyl)-1,3,5-oxadiazinane (PubChem CID 67624248) has the molecular formula C7H16N2O3 and a molecular weight of 176.22 g/mol. Its IUPAC name is 3,5-bis(methoxymethyl)-1,3,5-oxadiazinane.
| Compound Name | 3,5-bis(methoxymethyl)-1,3,5-oxadiazinane |
|---|---|
| PubChem CID | 67624248 |
| Molecular Formula | C7H16N2O3 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 3,5-bis(methoxymethyl)-1,3,5-oxadiazinane |
| SMILES | COCN1COCN(COC)C1 |
| InChI | InChI=1S/C7H16N2O3/c1-10-4-8-3-9(5-11-2)7-12-6-8/h3-7H2,1-2H3 |
| InChIKey | VWOZINIQXPXBCY-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |