About 3,5-bis(methoxymethyl)-1,3,5-oxadiazinane
3,5-bis(methoxymethyl)-1,3,5-oxadiazinane (PubChem CID 67624248) has the molecular formula C7H16N2O3
and a molecular weight of 176.22 g/mol. Its IUPAC name is 3,5-bis(methoxymethyl)-1,3,5-oxadiazinane.
Molecular Properties
| Compound Name | 3,5-bis(methoxymethyl)-1,3,5-oxadiazinane |
| PubChem CID | 67624248 |
| Molecular Formula | C7H16N2O3 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 3,5-bis(methoxymethyl)-1,3,5-oxadiazinane |
| SMILES | COCN1COCN(COC)C1 |
| InChI | InChI=1S/C7H16N2O3/c1-10-4-8-3-9(5-11-2)7-12-6-8/h3-7H2,1-2H3 |
| InChIKey | VWOZINIQXPXBCY-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3,5-bis(methoxymethyl)-1,3,5-oxadiazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-bis(methoxymethyl)-1,3,5-oxadiazinane?
The IUPAC name of 3,5-bis(methoxymethyl)-1,3,5-oxadiazinane (CID 67624248) is 3,5-bis(methoxymethyl)-1,3,5-oxadiazinane.
What is the SMILES notation for 3,5-bis(methoxymethyl)-1,3,5-oxadiazinane?
The canonical SMILES for 3,5-bis(methoxymethyl)-1,3,5-oxadiazinane is COCN1COCN(COC)C1.
What is the InChIKey of 3,5-bis(methoxymethyl)-1,3,5-oxadiazinane?
The InChIKey is VWOZINIQXPXBCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O3/c1-10-4-8-3-9(5-11-2)7-12-6-8/h3-7H2,1-2H3.
What are the key properties of 3,5-bis(methoxymethyl)-1,3,5-oxadiazinane?
3,5-bis(methoxymethyl)-1,3,5-oxadiazinane has a molecular weight of 176.22 g/mol, XLogP of -0.30, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-bis(methoxymethyl)-1,3,5-oxadiazinane is sourced from PubChem (CID 67624248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).