About 3-(hydroxymethyl)-5-(methoxymethyl)-1,3,5-oxadiazinan-4-one
3-(hydroxymethyl)-5-(methoxymethyl)-1,3,5-oxadiazinan-4-one (PubChem CID 23262911) has the molecular formula C6H12N2O4
and a molecular weight of 176.17 g/mol. Its IUPAC name is 3-(hydroxymethyl)-5-(methoxymethyl)-1,3,5-oxadiazinan-4-one.
Molecular Properties
| Compound Name | 3-(hydroxymethyl)-5-(methoxymethyl)-1,3,5-oxadiazinan-4-one |
| PubChem CID | 23262911 |
| Molecular Formula | C6H12N2O4 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 3-(hydroxymethyl)-5-(methoxymethyl)-1,3,5-oxadiazinan-4-one |
| SMILES | COCN1COCN(CO)C1=O |
| InChI | InChI=1S/C6H12N2O4/c1-11-3-8-5-12-4-7(2-9)6(8)10/h9H,2-5H2,1H3 |
| InChIKey | VGXNBPIOIBSUMT-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(hydroxymethyl)-5-(methoxymethyl)-1,3,5-oxadiazinan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(hydroxymethyl)-5-(methoxymethyl)-1,3,5-oxadiazinan-4-one?
The IUPAC name of 3-(hydroxymethyl)-5-(methoxymethyl)-1,3,5-oxadiazinan-4-one (CID 23262911) is 3-(hydroxymethyl)-5-(methoxymethyl)-1,3,5-oxadiazinan-4-one.
What is the SMILES notation for 3-(hydroxymethyl)-5-(methoxymethyl)-1,3,5-oxadiazinan-4-one?
The canonical SMILES for 3-(hydroxymethyl)-5-(methoxymethyl)-1,3,5-oxadiazinan-4-one is COCN1COCN(CO)C1=O.
What is the InChIKey of 3-(hydroxymethyl)-5-(methoxymethyl)-1,3,5-oxadiazinan-4-one?
The InChIKey is VGXNBPIOIBSUMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O4/c1-11-3-8-5-12-4-7(2-9)6(8)10/h9H,2-5H2,1H3.
What are the key properties of 3-(hydroxymethyl)-5-(methoxymethyl)-1,3,5-oxadiazinan-4-one?
3-(hydroxymethyl)-5-(methoxymethyl)-1,3,5-oxadiazinan-4-one has a molecular weight of 176.17 g/mol, XLogP of -0.79, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(hydroxymethyl)-5-(methoxymethyl)-1,3,5-oxadiazinan-4-one is sourced from PubChem (CID 23262911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).