About 1-(hydroxymethyl)-3,5-dimethyl-1,3,5-triazinan-2-one
1-(hydroxymethyl)-3,5-dimethyl-1,3,5-triazinan-2-one (PubChem CID 20648429) has the molecular formula C6H13N3O2
and a molecular weight of 159.19 g/mol. Its IUPAC name is 1-(hydroxymethyl)-3,5-dimethyl-1,3,5-triazinan-2-one.
Analyze 1-(hydroxymethyl)-3,5-dimethyl-1,3,5-triazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(hydroxymethyl)-3,5-dimethyl-1,3,5-triazinan-2-one?
The IUPAC name of 1-(hydroxymethyl)-3,5-dimethyl-1,3,5-triazinan-2-one (CID 20648429) is 1-(hydroxymethyl)-3,5-dimethyl-1,3,5-triazinan-2-one.
What is the SMILES notation for 1-(hydroxymethyl)-3,5-dimethyl-1,3,5-triazinan-2-one?
The canonical SMILES for 1-(hydroxymethyl)-3,5-dimethyl-1,3,5-triazinan-2-one is CN1CN(C)C(=O)N(CO)C1.
What is the InChIKey of 1-(hydroxymethyl)-3,5-dimethyl-1,3,5-triazinan-2-one?
The InChIKey is RRXCQKHJZBQZEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N3O2/c1-7-3-8(2)6(11)9(4-7)5-10/h10H,3-5H2,1-2H3.
What are the key properties of 1-(hydroxymethyl)-3,5-dimethyl-1,3,5-triazinan-2-one?
1-(hydroxymethyl)-3,5-dimethyl-1,3,5-triazinan-2-one has a molecular weight of 159.19 g/mol, XLogP of -0.85, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(hydroxymethyl)-3,5-dimethyl-1,3,5-triazinan-2-one is sourced from PubChem (CID 20648429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).