C5H12N2O3 — CID 10374592
1,3-bis(hydroxymethyl)-1,3-dimethylurea (PubChem CID 10374592) has the molecular formula C5H12N2O3 and a molecular weight of 148.16 g/mol. Its IUPAC name is 1,3-bis(hydroxymethyl)-1,3-dimethylurea.
| Compound Name | 1,3-bis(hydroxymethyl)-1,3-dimethylurea |
|---|---|
| PubChem CID | 10374592 |
| Molecular Formula | C5H12N2O3 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.08 |
| IUPAC Name | 1,3-bis(hydroxymethyl)-1,3-dimethylurea |
| SMILES | CN(CO)C(=O)N(C)CO |
| InChI | InChI=1S/C5H12N2O3/c1-6(3-8)5(10)7(2)4-9/h8-9H,3-4H2,1-2H3 |
| InChIKey | MSISRBNSEDYCOX-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|