C22H14FNO4 — CID 174523779
3-amino-5-benzoyl-4-[2-(4-fluorophenyl)ethynyl]-2-hydroxybenzoic acid (PubChem CID 174523779) has the molecular formula C22H14FNO4 and a molecular weight of 375.36 g/mol. Its IUPAC name is 3-amino-5-benzoyl-4-[2-(4-fluorophenyl)ethynyl]-2-hydroxybenzoic acid.
| Compound Name | 3-amino-5-benzoyl-4-[2-(4-fluorophenyl)ethynyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 174523779 |
| Molecular Formula | C22H14FNO4 |
| Molecular Weight | 375.36 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 3-amino-5-benzoyl-4-[2-(4-fluorophenyl)ethynyl]-2-hydroxybenzoic acid |
| SMILES | Nc1c(O)c(C(=O)O)cc(C(=O)c2ccccc2)c1C#Cc1ccc(F)cc1 |
| InChI | InChI=1S/C22H14FNO4/c23-15-9-6-13(7-10-15)8-11-16-17(20(25)14-4-2-1-3-5-14)12-18(22(27)28)21(26)19(16)24/h1-7,9-10,12,26H,24H2,(H,27,28) |
| InChIKey | BRPXNHJHOYYJRS-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|