C24H34N4O — CID 174525515
N-(3-aminopropyl)-4-methyl-N-[4-[(2-methylphenyl)methoxy]phenyl]piperidine-1-carboximidamide (PubChem CID 174525515) has the molecular formula C24H34N4O and a molecular weight of 394.56 g/mol. Its IUPAC name is N-(3-aminopropyl)-4-methyl-N-[4-[(2-methylphenyl)methoxy]phenyl]piperidine-1-carboximidamide.
| Compound Name | N-(3-aminopropyl)-4-methyl-N-[4-[(2-methylphenyl)methoxy]phenyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 174525515 |
| Molecular Formula | C24H34N4O |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | N-(3-aminopropyl)-4-methyl-N-[4-[(2-methylphenyl)methoxy]phenyl]piperidine-1-carboximidamide |
| SMILES | [H]/N=C(\N1CCC(C)CC1)N(CCCN)c1ccc(OCc2ccccc2C)cc1 |
| InChI | InChI=1S/C24H34N4O/c1-19-12-16-27(17-13-19)24(26)28(15-5-14-25)22-8-10-23(11-9-22)29-18-21-7-4-3-6-20(21)2/h3-4,6-11,19,26H,5,12-18,25H2,1-2H3/b26-24+ |
| InChIKey | UFWPAANTNBDKPB-SHHOIMCASA-N |
| XLogP | 4.40 |
| TPSA | 65.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|