About N-(3-amino-2,2-dimethylpropyl)-3-methyl-N-(4-propoxyphenyl)piperidine-1-carboximidamide
N-(3-amino-2,2-dimethylpropyl)-3-methyl-N-(4-propoxyphenyl)piperidine-1-carboximidamide (PubChem CID 175250986) has the molecular formula C21H36N4O
and a molecular weight of 360.55 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylpropyl)-3-methyl-N-(4-propoxyphenyl)piperidine-1-carboximidamide.
Molecular Properties
| Compound Name | N-(3-amino-2,2-dimethylpropyl)-3-methyl-N-(4-propoxyphenyl)piperidine-1-carboximidamide |
| PubChem CID | 175250986 |
| Molecular Formula | C21H36N4O |
| Molecular Weight | 360.55 g/mol |
| Exact Mass | 360.29 |
| IUPAC Name | N-(3-amino-2,2-dimethylpropyl)-3-methyl-N-(4-propoxyphenyl)piperidine-1-carboximidamide |
| SMILES | [H]/N=C(\N1CCCC(C)C1)N(CC(C)(C)CN)c1ccc(OCCC)cc1 |
| InChI | InChI=1S/C21H36N4O/c1-5-13-26-19-10-8-18(9-11-19)25(16-21(3,4)15-22)20(23)24-12-6-7-17(2)14-24/h8-11,17,23H,5-7,12-16,22H2,1-4H3/b23-20+ |
| InChIKey | RHZYFFNVDGLMOR-BSYVCWPDSA-N |
| XLogP | 3.93 |
| TPSA | 65.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.55 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(3-amino-2,2-dimethylpropyl)-3-methyl-N-(4-propoxyphenyl)piperidine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-amino-2,2-dimethylpropyl)-3-methyl-N-(4-propoxyphenyl)piperidine-1-carboximidamide?
The IUPAC name of N-(3-amino-2,2-dimethylpropyl)-3-methyl-N-(4-propoxyphenyl)piperidine-1-carboximidamide (CID 175250986) is N-(3-amino-2,2-dimethylpropyl)-3-methyl-N-(4-propoxyphenyl)piperidine-1-carboximidamide.
What is the SMILES notation for N-(3-amino-2,2-dimethylpropyl)-3-methyl-N-(4-propoxyphenyl)piperidine-1-carboximidamide?
The canonical SMILES for N-(3-amino-2,2-dimethylpropyl)-3-methyl-N-(4-propoxyphenyl)piperidine-1-carboximidamide is [H]/N=C(\N1CCCC(C)C1)N(CC(C)(C)CN)c1ccc(OCCC)cc1.
What is the InChIKey of N-(3-amino-2,2-dimethylpropyl)-3-methyl-N-(4-propoxyphenyl)piperidine-1-carboximidamide?
The InChIKey is RHZYFFNVDGLMOR-BSYVCWPDSA-N. The full InChI is InChI=1S/C21H36N4O/c1-5-13-26-19-10-8-18(9-11-19)25(16-21(3,4)15-22)20(23)24-12-6-7-17(2)14-24/h8-11,17,23H,5-7,12-16,22H2,1-4H3/b23-20+.
What are the key properties of N-(3-amino-2,2-dimethylpropyl)-3-methyl-N-(4-propoxyphenyl)piperidine-1-carboximidamide?
N-(3-amino-2,2-dimethylpropyl)-3-methyl-N-(4-propoxyphenyl)piperidine-1-carboximidamide has a molecular weight of 360.55 g/mol, XLogP of 3.93, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-amino-2,2-dimethylpropyl)-3-methyl-N-(4-propoxyphenyl)piperidine-1-carboximidamide is sourced from PubChem (CID 175250986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).