C27H40N4O — CID 174525535
N-(3-amino-2,2-dimethylpropyl)-2-ethyl-N-[4-[(4-methylphenyl)methoxy]phenyl]piperidine-1-carboximidamide (PubChem CID 174525535) has the molecular formula C27H40N4O and a molecular weight of 436.64 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylpropyl)-2-ethyl-N-[4-[(4-methylphenyl)methoxy]phenyl]piperidine-1-carboximidamide.
| Compound Name | N-(3-amino-2,2-dimethylpropyl)-2-ethyl-N-[4-[(4-methylphenyl)methoxy]phenyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 174525535 |
| Molecular Formula | C27H40N4O |
| Molecular Weight | 436.64 g/mol |
| Exact Mass | 436.32 |
| IUPAC Name | N-(3-amino-2,2-dimethylpropyl)-2-ethyl-N-[4-[(4-methylphenyl)methoxy]phenyl]piperidine-1-carboximidamide |
| SMILES | [H]/N=C(/N(CC(C)(C)CN)c1ccc(OCc2ccc(C)cc2)cc1)N1CCCCC1CC |
| InChI | InChI=1S/C27H40N4O/c1-5-23-8-6-7-17-30(23)26(29)31(20-27(3,4)19-28)24-13-15-25(16-14-24)32-18-22-11-9-21(2)10-12-22/h9-16,23,29H,5-8,17-20,28H2,1-4H3/b29-26+ |
| InChIKey | KJIAFJWOAGBTNB-PBBVDAKRSA-N |
| XLogP | 5.56 |
| TPSA | 65.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.64 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|