C26H35N5O — CID 174525534
N-(3-amino-2,2-dimethylpropyl)-N-[4-[(4-cyanophenyl)methoxy]phenyl]-2-methylpiperidine-1-carboximidamide (PubChem CID 174525534) has the molecular formula C26H35N5O and a molecular weight of 433.60 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylpropyl)-N-[4-[(4-cyanophenyl)methoxy]phenyl]-2-methylpiperidine-1-carboximidamide.
| Compound Name | N-(3-amino-2,2-dimethylpropyl)-N-[4-[(4-cyanophenyl)methoxy]phenyl]-2-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 174525534 |
| Molecular Formula | C26H35N5O |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.28 |
| IUPAC Name | N-(3-amino-2,2-dimethylpropyl)-N-[4-[(4-cyanophenyl)methoxy]phenyl]-2-methylpiperidine-1-carboximidamide |
| SMILES | [H]/N=C(/N(CC(C)(C)CN)c1ccc(OCc2ccc(C#N)cc2)cc1)N1CCCCC1C |
| InChI | InChI=1S/C26H35N5O/c1-20-6-4-5-15-30(20)25(29)31(19-26(2,3)18-28)23-11-13-24(14-12-23)32-17-22-9-7-21(16-27)8-10-22/h7-14,20,29H,4-6,15,17-19,28H2,1-3H3/b29-25+ |
| InChIKey | JWACPNMCJJTJGU-XLVZBRSZSA-N |
| XLogP | 4.74 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|